2-octyldecanoic acid

🙚 Home 🙚 Tables for Chemistry 🙘 Compound classes 🙘

2-octyldecanoic acid
Links:🕷 ChemSpider
Formula:C18H36O2; 284.48 g/mol
InChiKey:OYYXZGFIZTYYRB-UHFFFAOYSA-N
SMILES:CCCCCCCCC(CCCCCCCC)C(O)=O
Molecular structure of 2-octyldecanoic acid
Melting point:39 °C

Isomers

decyl 2-ethylhexanoate
Molecular structure of decyl 2-ethylhexanoate
ethyl hexadecanoate
Molecular structure of ethyl hexadecanoate
1-hexadecyl acetate
Molecular structure of 1-hexadecyl acetate
hexyl dodecanoate
Molecular structure of hexyl dodecanoate
methyl heptadecanoate
Molecular structure of methyl heptadecanoate
octadecanoic acid
Molecular structure of octadecanoic acid
2-octyldecanoic acid
Molecular structure of 2-octyldecanoic acid
  ::